C33H54O6 — CID 22833452
tris(3-ethyl-2-methylpentyl) benzene-1,2,4-tricarboxylate (PubChem CID 22833452) has the molecular formula C33H54O6 and a molecular weight of 546.79 g/mol. Its IUPAC name is tris(3-ethyl-2-methylpentyl) benzene-1,2,4-tricarboxylate.
| Compound Name | tris(3-ethyl-2-methylpentyl) benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 22833452 |
| Molecular Formula | C33H54O6 |
| Molecular Weight | 546.79 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | tris(3-ethyl-2-methylpentyl) benzene-1,2,4-tricarboxylate |
| SMILES | CCC(CC)C(C)COC(=O)c1ccc(C(=O)OCC(C)C(CC)CC)c(C(=O)OCC(C)C(CC)CC)c1 |
| InChI | InChI=1S/C33H54O6/c1-10-25(11-2)22(7)19-37-31(34)28-16-17-29(32(35)38-20-23(8)26(12-3)13-4)30(18-28)33(36)39-21-24(9)27(14-5)15-6/h16-18,22-27H,10-15,19-21H2,1-9H3 |
| InChIKey | TTXANHKIIWHKOU-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.79 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|