C18H18Br6O6 — CID 22168298
tris(2,3-dibromopropyl) benzene-1,2,4-tricarboxylate (PubChem CID 22168298) has the molecular formula C18H18Br6O6 and a molecular weight of 809.76 g/mol. Its IUPAC name is tris(2,3-dibromopropyl) benzene-1,2,4-tricarboxylate.
| Compound Name | tris(2,3-dibromopropyl) benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 22168298 |
| Molecular Formula | C18H18Br6O6 |
| Molecular Weight | 809.76 g/mol |
| Exact Mass | 803.62 |
| IUPAC Name | tris(2,3-dibromopropyl) benzene-1,2,4-tricarboxylate |
| SMILES | O=C(OCC(Br)CBr)c1ccc(C(=O)OCC(Br)CBr)c(C(=O)OCC(Br)CBr)c1 |
| InChI | InChI=1S/C18H18Br6O6/c19-4-11(22)7-28-16(25)10-1-2-14(17(26)29-8-12(23)5-20)15(3-10)18(27)30-9-13(24)6-21/h1-3,11-13H,4-9H2 |
| InChIKey | VSGOCKFBHYRARP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.76 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|