C25H38O6 — CID 175702841
1-O,4-O-dibutyl 2-O-(2-ethylhexyl) benzene-1,2,4-tricarboxylate (PubChem CID 175702841) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is 1-O,4-O-dibutyl 2-O-(2-ethylhexyl) benzene-1,2,4-tricarboxylate.
| Compound Name | 1-O,4-O-dibutyl 2-O-(2-ethylhexyl) benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 175702841 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 1-O,4-O-dibutyl 2-O-(2-ethylhexyl) benzene-1,2,4-tricarboxylate |
| SMILES | CCCCOC(=O)c1ccc(C(=O)OCCCC)c(C(=O)OCC(CC)CCCC)c1 |
| InChI | InChI=1S/C25H38O6/c1-5-9-12-19(8-4)18-31-25(28)22-17-20(23(26)29-15-10-6-2)13-14-21(22)24(27)30-16-11-7-3/h13-14,17,19H,5-12,15-16,18H2,1-4H3 |
| InChIKey | NZETULNMBPGQBP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|