C28H48O5 — CID 157421675
bis(2-ethylhexyl) benzene-1,4-dicarboxylate;2-methylpropan-1-ol (PubChem CID 157421675) has the molecular formula C28H48O5 and a molecular weight of 464.69 g/mol. Its IUPAC name is bis(2-ethylhexyl) benzene-1,4-dicarboxylate;2-methylpropan-1-ol.
| Compound Name | bis(2-ethylhexyl) benzene-1,4-dicarboxylate;2-methylpropan-1-ol |
|---|---|
| PubChem CID | 157421675 |
| Molecular Formula | C28H48O5 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | bis(2-ethylhexyl) benzene-1,4-dicarboxylate;2-methylpropan-1-ol |
| SMILES | CC(C)CO.CCCCC(CC)COC(=O)c1ccc(C(=O)OCC(CC)CCCC)cc1 |
| InChI | InChI=1S/C24H38O4.C4H10O/c1-5-9-11-19(7-3)17-27-23(25)21-13-15-22(16-14-21)24(26)28-18-20(8-4)12-10-6-2;1-4(2)3-5/h13-16,19-20H,5-12,17-18H2,1-4H3;4-5H,3H2,1-2H3 |
| InChIKey | BPMCUWWFHVARKO-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |