C33H44O10 — CID 174956953
benzene-1,2,4-tricarboxylic acid;bis(2-ethylhexyl) benzene-1,4-dicarboxylate (PubChem CID 174956953) has the molecular formula C33H44O10 and a molecular weight of 600.71 g/mol. Its IUPAC name is benzene-1,2,4-tricarboxylic acid;bis(2-ethylhexyl) benzene-1,4-dicarboxylate.
| Compound Name | benzene-1,2,4-tricarboxylic acid;bis(2-ethylhexyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 174956953 |
| Molecular Formula | C33H44O10 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | benzene-1,2,4-tricarboxylic acid;bis(2-ethylhexyl) benzene-1,4-dicarboxylate |
| SMILES | CCCCC(CC)COC(=O)c1ccc(C(=O)OCC(CC)CCCC)cc1.O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H38O4.C9H6O6/c1-5-9-11-19(7-3)17-27-23(25)21-13-15-22(16-14-21)24(26)28-18-20(8-4)12-10-6-2;10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h13-16,19-20H,5-12,17-18H2,1-4H3;1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | YDPREPAAOVSZHZ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |