C24H34N2O4 — CID 67897666
2-aminobenzoic acid;2-ethylhexyl 4-(dimethylamino)benzoate (PubChem CID 67897666) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-aminobenzoic acid;2-ethylhexyl 4-(dimethylamino)benzoate.
| Compound Name | 2-aminobenzoic acid;2-ethylhexyl 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 67897666 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 2-aminobenzoic acid;2-ethylhexyl 4-(dimethylamino)benzoate |
| SMILES | CCCCC(CC)COC(=O)c1ccc(N(C)C)cc1.Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C17H27NO2.C7H7NO2/c1-5-7-8-14(6-2)13-20-17(19)15-9-11-16(12-10-15)18(3)4;8-6-4-2-1-3-5(6)7(9)10/h9-12,14H,5-8,13H2,1-4H3;1-4H,8H2,(H,9,10) |
| InChIKey | AGURWBNQKYBNIH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|