C27H41NO4 — CID 175396872
2-ethylhexyl 4-(dimethylamino)benzoate;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione (PubChem CID 175396872) has the molecular formula C27H41NO4 and a molecular weight of 443.63 g/mol. Its IUPAC name is 2-ethylhexyl 4-(dimethylamino)benzoate;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione.
| Compound Name | 2-ethylhexyl 4-(dimethylamino)benzoate;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
|---|---|
| PubChem CID | 175396872 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 2-ethylhexyl 4-(dimethylamino)benzoate;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
| SMILES | CC12CCC(C(=O)C1=O)C2(C)C.CCCCC(CC)COC(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H27NO2.C10H14O2/c1-5-7-8-14(6-2)13-20-17(19)15-9-11-16(12-10-15)18(3)4;1-9(2)6-4-5-10(9,3)8(12)7(6)11/h9-12,14H,5-8,13H2,1-4H3;6H,4-5H2,1-3H3 |
| InChIKey | QONFVODRGCOZET-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|