C19H23NO4 — CID 101352153
(7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl)methyl 4-(dimethylamino)benzoate (PubChem CID 101352153) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl)methyl 4-(dimethylamino)benzoate.
| Compound Name | (7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl)methyl 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 101352153 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl)methyl 4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OCC23CCC(C(=O)C2=O)C3(C)C)cc1 |
| InChI | InChI=1S/C19H23NO4/c1-18(2)14-9-10-19(18,16(22)15(14)21)11-24-17(23)12-5-7-13(8-6-12)20(3)4/h5-8,14H,9-11H2,1-4H3 |
| InChIKey | JITCLEJWWRKWNN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|