About 4-ethyloctan-2-yl 4-(dimethylamino)benzoate
4-ethyloctan-2-yl 4-(dimethylamino)benzoate (PubChem CID 91100903) has the molecular formula C19H31NO2
and a molecular weight of 305.46 g/mol. Its IUPAC name is 4-ethyloctan-2-yl 4-(dimethylamino)benzoate.
Molecular Properties
| Compound Name | 4-ethyloctan-2-yl 4-(dimethylamino)benzoate |
| PubChem CID | 91100903 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 4-ethyloctan-2-yl 4-(dimethylamino)benzoate |
| SMILES | CCCCC(CC)CC(C)OC(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H31NO2/c1-6-8-9-16(7-2)14-15(3)22-19(21)17-10-12-18(13-11-17)20(4)5/h10-13,15-16H,6-9,14H2,1-5H3 |
| InChIKey | KFDQLMXBKPSJPT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyloctan-2-yl 4-(dimethylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyloctan-2-yl 4-(dimethylamino)benzoate?
The IUPAC name of 4-ethyloctan-2-yl 4-(dimethylamino)benzoate (CID 91100903) is 4-ethyloctan-2-yl 4-(dimethylamino)benzoate.
What is the SMILES notation for 4-ethyloctan-2-yl 4-(dimethylamino)benzoate?
The canonical SMILES for 4-ethyloctan-2-yl 4-(dimethylamino)benzoate is CCCCC(CC)CC(C)OC(=O)c1ccc(N(C)C)cc1.
What is the InChIKey of 4-ethyloctan-2-yl 4-(dimethylamino)benzoate?
The InChIKey is KFDQLMXBKPSJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NO2/c1-6-8-9-16(7-2)14-15(3)22-19(21)17-10-12-18(13-11-17)20(4)5/h10-13,15-16H,6-9,14H2,1-5H3.
What are the key properties of 4-ethyloctan-2-yl 4-(dimethylamino)benzoate?
4-ethyloctan-2-yl 4-(dimethylamino)benzoate has a molecular weight of 305.46 g/mol, XLogP of 4.90, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyloctan-2-yl 4-(dimethylamino)benzoate is sourced from PubChem (CID 91100903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).