C18H18O9 — CID 98048405
2-O,4-O-bis[[(2S)-oxiran-2-yl]methyl] 1-O-[[(2R)-oxiran-2-yl]methyl] benzene-1,2,4-tricarboxylate (PubChem CID 98048405) has the molecular formula C18H18O9 and a molecular weight of 378.33 g/mol. Its IUPAC name is 2-O,4-O-bis[[(2S)-oxiran-2-yl]methyl] 1-O-[[(2R)-oxiran-2-yl]methyl] benzene-1,2,4-tricarboxylate.
| Compound Name | 2-O,4-O-bis[[(2S)-oxiran-2-yl]methyl] 1-O-[[(2R)-oxiran-2-yl]methyl] benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 98048405 |
| Molecular Formula | C18H18O9 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-O,4-O-bis[[(2S)-oxiran-2-yl]methyl] 1-O-[[(2R)-oxiran-2-yl]methyl] benzene-1,2,4-tricarboxylate |
| SMILES | O=C(OC[C@@H]1CO1)c1ccc(C(=O)OC[C@H]2CO2)c(C(=O)OC[C@@H]2CO2)c1 |
| InChI | InChI=1S/C18H18O9/c19-16(25-7-11-4-22-11)10-1-2-14(17(20)26-8-12-5-23-12)15(3-10)18(21)27-9-13-6-24-13/h1-3,11-13H,4-9H2/t11-,12+,13-/m0/s1 |
| InChIKey | YNOWBNNLZSSIHM-XQQFMLRXSA-N |
| XLogP | 0.35 |
| TPSA | 116.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|