C41H36O16 — CID 162487974
oxiran-2-ylmethyl 4-[tris[4-(oxiran-2-ylmethoxycarbonyl)phenoxy]methoxy]benzoate (PubChem CID 162487974) has the molecular formula C41H36O16 and a molecular weight of 784.72 g/mol. Its IUPAC name is oxiran-2-ylmethyl 4-[tris[4-(oxiran-2-ylmethoxycarbonyl)phenoxy]methoxy]benzoate.
| Compound Name | oxiran-2-ylmethyl 4-[tris[4-(oxiran-2-ylmethoxycarbonyl)phenoxy]methoxy]benzoate |
|---|---|
| PubChem CID | 162487974 |
| Molecular Formula | C41H36O16 |
| Molecular Weight | 784.72 g/mol |
| Exact Mass | 784.20 |
| IUPAC Name | oxiran-2-ylmethyl 4-[tris[4-(oxiran-2-ylmethoxycarbonyl)phenoxy]methoxy]benzoate |
| SMILES | O=C(OCC1CO1)c1ccc(OC(Oc2ccc(C(=O)OCC3CO3)cc2)(Oc2ccc(C(=O)OCC3CO3)cc2)Oc2ccc(C(=O)OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C41H36O16/c42-37(50-21-33-17-46-33)25-1-9-29(10-2-25)54-41(55-30-11-3-26(4-12-30)38(43)51-22-34-18-47-34,56-31-13-5-27(6-14-31)39(44)52-23-35-19-48-35)57-32-15-7-28(8-16-32)40(45)53-24-36-20-49-36/h1-16,33-36H,17-24H2 |
| InChIKey | DKXGZOKQLJXHOR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 192.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|