C38H36N2O8 — CID 101211626
oxiran-2-ylmethyl 4-[[4-[4-[4-[[4-(oxiran-2-ylmethoxycarbonyl)phenyl]iminomethyl]phenoxy]butoxy]phenyl]methylideneamino]benzoate (PubChem CID 101211626) has the molecular formula C38H36N2O8 and a molecular weight of 648.71 g/mol. Its IUPAC name is oxiran-2-ylmethyl 4-[[4-[4-[4-[[4-(oxiran-2-ylmethoxycarbonyl)phenyl]iminomethyl]phenoxy]butoxy]phenyl]methylideneamino]benzoate.
| Compound Name | oxiran-2-ylmethyl 4-[[4-[4-[4-[[4-(oxiran-2-ylmethoxycarbonyl)phenyl]iminomethyl]phenoxy]butoxy]phenyl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 101211626 |
| Molecular Formula | C38H36N2O8 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | oxiran-2-ylmethyl 4-[[4-[4-[4-[[4-(oxiran-2-ylmethoxycarbonyl)phenyl]iminomethyl]phenoxy]butoxy]phenyl]methylideneamino]benzoate |
| SMILES | O=C(OCC1CO1)c1ccc(/N=C/c2ccc(OCCCCOc3ccc(/C=N/c4ccc(C(=O)OCC5CO5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H36N2O8/c41-37(47-25-35-23-45-35)29-7-11-31(12-8-29)39-21-27-3-15-33(16-4-27)43-19-1-2-20-44-34-17-5-28(6-18-34)22-40-32-13-9-30(10-14-32)38(42)48-26-36-24-46-36/h3-18,21-22,35-36H,1-2,19-20,23-26H2/b39-21+,40-22+ |
| InChIKey | OOGHJVUDOBSGSM-NJHHXWHYSA-N |
| XLogP | 6.54 |
| TPSA | 120.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|