C34H40N2O6 — CID 101226440
1-[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]-N-[4-[[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]methylideneamino]phenyl]methanimine (PubChem CID 101226440) has the molecular formula C34H40N2O6 and a molecular weight of 572.70 g/mol. Its IUPAC name is 1-[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]-N-[4-[[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]methylideneamino]phenyl]methanimine.
| Compound Name | 1-[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]-N-[4-[[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]methylideneamino]phenyl]methanimine |
|---|---|
| PubChem CID | 101226440 |
| Molecular Formula | C34H40N2O6 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 1-[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]-N-[4-[[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]methylideneamino]phenyl]methanimine |
| SMILES | C(=N/c1ccc(/N=C/c2ccc(OCCCCOCC3CO3)cc2)cc1)\c1ccc(OCCCCOCC2CO2)cc1 |
| InChI | InChI=1S/C34H40N2O6/c1(17-37-23-33-25-41-33)3-19-39-31-13-5-27(6-14-31)21-35-29-9-11-30(12-10-29)36-22-28-7-15-32(16-8-28)40-20-4-2-18-38-24-34-26-42-34/h5-16,21-22,33-34H,1-4,17-20,23-26H2/b35-21+,36-22+ |
| InChIKey | BBSRKFOJXRQCSZ-JTOYJDTJSA-N |
| XLogP | 6.34 |
| TPSA | 86.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|