C29H24O9 — CID 161259283
1-O-[4-(cyclopropylmethoxycarbonyl)phenyl] 4-O-[4-(oxiran-2-ylmethoxycarbonyl)phenyl] benzene-1,4-dicarboxylate (PubChem CID 161259283) has the molecular formula C29H24O9 and a molecular weight of 516.50 g/mol. Its IUPAC name is 1-O-[4-(cyclopropylmethoxycarbonyl)phenyl] 4-O-[4-(oxiran-2-ylmethoxycarbonyl)phenyl] benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[4-(cyclopropylmethoxycarbonyl)phenyl] 4-O-[4-(oxiran-2-ylmethoxycarbonyl)phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 161259283 |
| Molecular Formula | C29H24O9 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 1-O-[4-(cyclopropylmethoxycarbonyl)phenyl] 4-O-[4-(oxiran-2-ylmethoxycarbonyl)phenyl] benzene-1,4-dicarboxylate |
| SMILES | O=C(OCC1CC1)c1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(C(=O)OCC4CO4)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H24O9/c30-26(35-15-18-1-2-18)19-7-11-23(12-8-19)37-28(32)21-3-5-22(6-4-21)29(33)38-24-13-9-20(10-14-24)27(31)36-17-25-16-34-25/h3-14,18,25H,1-2,15-17H2 |
| InChIKey | GUTMWPVNJCYHGP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 117.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|