C10H8Cl2O6 — CID 21427911
4-O-chloro 1-O-(2,2-dihydroxyethyl) 2-chlorobenzene-1,4-dicarboxylate (PubChem CID 21427911) has the molecular formula C10H8Cl2O6 and a molecular weight of 295.07 g/mol. Its IUPAC name is 4-O-chloro 1-O-(2,2-dihydroxyethyl) 2-chlorobenzene-1,4-dicarboxylate.
| Compound Name | 4-O-chloro 1-O-(2,2-dihydroxyethyl) 2-chlorobenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 21427911 |
| Molecular Formula | C10H8Cl2O6 |
| Molecular Weight | 295.07 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 4-O-chloro 1-O-(2,2-dihydroxyethyl) 2-chlorobenzene-1,4-dicarboxylate |
| SMILES | O=C(OCl)c1ccc(C(=O)OCC(O)O)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2O6/c11-7-3-5(9(15)18-12)1-2-6(7)10(16)17-4-8(13)14/h1-3,8,13-14H,4H2 |
| InChIKey | KYHBRHVDUOOJOB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.07 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|