C18H27LiO7S — CID 173139451
lithium;2,5-bis(2-methylbutoxycarbonyl)benzenesulfonic acid;hydride (PubChem CID 173139451) has the molecular formula C18H27LiO7S and a molecular weight of 394.42 g/mol. Its IUPAC name is lithium;2,5-bis(2-methylbutoxycarbonyl)benzenesulfonic acid;hydride.
| Compound Name | lithium;2,5-bis(2-methylbutoxycarbonyl)benzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 173139451 |
| Molecular Formula | C18H27LiO7S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | lithium;2,5-bis(2-methylbutoxycarbonyl)benzenesulfonic acid;hydride |
| SMILES | CCC(C)COC(=O)c1ccc(C(=O)OCC(C)CC)c(S(=O)(=O)O)c1.[H-].[Li+] |
| InChI | InChI=1S/C18H26O7S.Li.H/c1-5-12(3)10-24-17(19)14-7-8-15(16(9-14)26(21,22)23)18(20)25-11-13(4)6-2;;/h7-9,12-13H,5-6,10-11H2,1-4H3,(H,21,22,23);;/q;+1;-1 |
| InChIKey | GNCXUANNKJKIJJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|