About 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate
2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate (PubChem CID 176756039) has the molecular formula C18H20N2O3
and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate.
Molecular Properties
| Compound Name | 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate |
| PubChem CID | 176756039 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate |
| SMILES | CCC(C)COC(=O)c1ccc(/N=N/c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O3/c1-3-13(2)12-23-18(22)14-4-6-15(7-5-14)19-20-16-8-10-17(21)11-9-16/h4-11,13,21H,3,12H2,1-2H3/b20-19+ |
| InChIKey | ZNOPOCJPSDKTCR-FMQUCBEESA-N |
| XLogP | 5.01 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate?
The IUPAC name of 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate (CID 176756039) is 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate.
What is the SMILES notation for 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate?
The canonical SMILES for 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate is CCC(C)COC(=O)c1ccc(/N=N/c2ccc(O)cc2)cc1.
What is the InChIKey of 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate?
The InChIKey is ZNOPOCJPSDKTCR-FMQUCBEESA-N. The full InChI is InChI=1S/C18H20N2O3/c1-3-13(2)12-23-18(22)14-4-6-15(7-5-14)19-20-16-8-10-17(21)11-9-16/h4-11,13,21H,3,12H2,1-2H3/b20-19+.
What are the key properties of 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate?
2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate has a molecular weight of 312.37 g/mol, XLogP of 5.01, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl 4-[(4-hydroxyphenyl)diazenyl]benzoate is sourced from PubChem (CID 176756039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).