About 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate
2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate (PubChem CID 54391249) has the molecular formula C29H46O5
and a molecular weight of 474.68 g/mol. Its IUPAC name is 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate.
Molecular Properties
| Compound Name | 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate |
| PubChem CID | 54391249 |
| Molecular Formula | C29H46O5 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate |
| SMILES | CCC(C)CO.CCC(C)COC(=O)c1ccc2ccccc2c1.CCCOC(=O)C(C)CC |
| InChI | InChI=1S/C16H18O2.C8H16O2.C5H12O/c1-3-12(2)11-18-16(17)15-9-8-13-6-4-5-7-14(13)10-15;1-4-6-10-8(9)7(3)5-2;1-3-5(2)4-6/h4-10,12H,3,11H2,1-2H3;7H,4-6H2,1-3H3;5-6H,3-4H2,1-2H3 |
| InChIKey | VGUFMNRFKAUAPJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate?
The IUPAC name of 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate (CID 54391249) is 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate.
What is the SMILES notation for 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate?
The canonical SMILES for 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate is CCC(C)CO.CCC(C)COC(=O)c1ccc2ccccc2c1.CCCOC(=O)C(C)CC.
What is the InChIKey of 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate?
The InChIKey is VGUFMNRFKAUAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O2.C8H16O2.C5H12O/c1-3-12(2)11-18-16(17)15-9-8-13-6-4-5-7-14(13)10-15;1-4-6-10-8(9)7(3)5-2;1-3-5(2)4-6/h4-10,12H,3,11H2,1-2H3;7H,4-6H2,1-3H3;5-6H,3-4H2,1-2H3.
What are the key properties of 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate?
2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate has a molecular weight of 474.68 g/mol, XLogP of 7.05, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-1-ol;2-methylbutyl naphthalene-2-carboxylate;propyl 2-methylbutanoate is sourced from PubChem (CID 54391249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).