C20H24O5 — CID 23531659
2-[2-(2-methylbutanoyloxy)ethoxy]ethyl naphthalene-2-carboxylate (PubChem CID 23531659) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[2-(2-methylbutanoyloxy)ethoxy]ethyl naphthalene-2-carboxylate.
| Compound Name | 2-[2-(2-methylbutanoyloxy)ethoxy]ethyl naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 23531659 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[2-(2-methylbutanoyloxy)ethoxy]ethyl naphthalene-2-carboxylate |
| SMILES | CCC(C)C(=O)OCCOCCOC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H24O5/c1-3-15(2)19(21)24-12-10-23-11-13-25-20(22)18-9-8-16-6-4-5-7-17(16)14-18/h4-9,14-15H,3,10-13H2,1-2H3 |
| InChIKey | GANLIRDPLWFUSW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|