About 2-propylpentyl naphthalene-2-carboxylate
2-propylpentyl naphthalene-2-carboxylate (PubChem CID 146351385) has the molecular formula C19H24O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-propylpentyl naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | 2-propylpentyl naphthalene-2-carboxylate |
| PubChem CID | 146351385 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2-propylpentyl naphthalene-2-carboxylate |
| SMILES | CCCC(CCC)COC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H24O2/c1-3-7-15(8-4-2)14-21-19(20)18-12-11-16-9-5-6-10-17(16)13-18/h5-6,9-13,15H,3-4,7-8,14H2,1-2H3 |
| InChIKey | UMCAVJBNYXVHBT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propylpentyl naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylpentyl naphthalene-2-carboxylate?
The IUPAC name of 2-propylpentyl naphthalene-2-carboxylate (CID 146351385) is 2-propylpentyl naphthalene-2-carboxylate.
What is the SMILES notation for 2-propylpentyl naphthalene-2-carboxylate?
The canonical SMILES for 2-propylpentyl naphthalene-2-carboxylate is CCCC(CCC)COC(=O)c1ccc2ccccc2c1.
What is the InChIKey of 2-propylpentyl naphthalene-2-carboxylate?
The InChIKey is UMCAVJBNYXVHBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O2/c1-3-7-15(8-4-2)14-21-19(20)18-12-11-16-9-5-6-10-17(16)13-18/h5-6,9-13,15H,3-4,7-8,14H2,1-2H3.
What are the key properties of 2-propylpentyl naphthalene-2-carboxylate?
2-propylpentyl naphthalene-2-carboxylate has a molecular weight of 284.40 g/mol, XLogP of 5.21, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylpentyl naphthalene-2-carboxylate is sourced from PubChem (CID 146351385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).