About 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol
4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol (PubChem CID 69279827) has the molecular formula C27H20O8
and a molecular weight of 472.45 g/mol. Its IUPAC name is 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol.
Molecular Properties
| Compound Name | 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol |
| PubChem CID | 69279827 |
| Molecular Formula | C27H20O8 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol |
| SMILES | O=C(O)c1ccc(OC(=O)c2ccc(C(=O)O)cc2)cc1.Oc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C15H10O6.C12H10O2/c16-13(17)9-1-3-11(4-2-9)15(20)21-12-7-5-10(6-8-12)14(18)19;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,(H,16,17)(H,18,19);1-8,13-14H |
| InChIKey | GLSSZECWWOCYRF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol?
The IUPAC name of 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol (CID 69279827) is 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol.
What is the SMILES notation for 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol?
The canonical SMILES for 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol is O=C(O)c1ccc(OC(=O)c2ccc(C(=O)O)cc2)cc1.Oc1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol?
The InChIKey is GLSSZECWWOCYRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O6.C12H10O2/c16-13(17)9-1-3-11(4-2-9)15(20)21-12-7-5-10(6-8-12)14(18)19;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,(H,16,17)(H,18,19);1-8,13-14H.
What are the key properties of 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol?
4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol has a molecular weight of 472.45 g/mol, XLogP of 5.07, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-carboxyphenoxy)carbonylbenzoic acid;4-(4-hydroxyphenyl)phenol is sourced from PubChem (CID 69279827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).