C28H37N3O7S — CID 13277316
methanesulfonic acid;[4-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazine-1-carbonyl]phenyl] 1,2,3,4-tetrahydronaphthalene-1-carboxylate (PubChem CID 13277316) has the molecular formula C28H37N3O7S and a molecular weight of 559.69 g/mol. Its IUPAC name is methanesulfonic acid;[4-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazine-1-carbonyl]phenyl] 1,2,3,4-tetrahydronaphthalene-1-carboxylate.
| Compound Name | methanesulfonic acid;[4-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazine-1-carbonyl]phenyl] 1,2,3,4-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 13277316 |
| Molecular Formula | C28H37N3O7S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | methanesulfonic acid;[4-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazine-1-carbonyl]phenyl] 1,2,3,4-tetrahydronaphthalene-1-carboxylate |
| SMILES | CC(C)NC(=O)CN1CCN(C(=O)c2ccc(OC(=O)C3CCCc4ccccc43)cc2)CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C27H33N3O4.CH4O3S/c1-19(2)28-25(31)18-29-14-16-30(17-15-29)26(32)21-10-12-22(13-11-21)34-27(33)24-9-5-7-20-6-3-4-8-23(20)24;1-5(2,3)4/h3-4,6,8,10-13,19,24H,5,7,9,14-18H2,1-2H3,(H,28,31);1H3,(H,2,3,4) |
| InChIKey | WXUVMQXIRSOLLW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|