C30H36ClN3O4 — CID 70522009
[4-[4-oxo-2-(piperazine-1-carbonyl)-4-pyrrolidin-1-ylbut-1-enyl]phenyl] 1,2,3,4-tetrahydronaphthalene-1-carboxylate;hydrochloride (PubChem CID 70522009) has the molecular formula C30H36ClN3O4 and a molecular weight of 538.09 g/mol. Its IUPAC name is [4-[4-oxo-2-(piperazine-1-carbonyl)-4-pyrrolidin-1-ylbut-1-enyl]phenyl] 1,2,3,4-tetrahydronaphthalene-1-carboxylate;hydrochloride.
| Compound Name | [4-[4-oxo-2-(piperazine-1-carbonyl)-4-pyrrolidin-1-ylbut-1-enyl]phenyl] 1,2,3,4-tetrahydronaphthalene-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70522009 |
| Molecular Formula | C30H36ClN3O4 |
| Molecular Weight | 538.09 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | [4-[4-oxo-2-(piperazine-1-carbonyl)-4-pyrrolidin-1-ylbut-1-enyl]phenyl] 1,2,3,4-tetrahydronaphthalene-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(Oc1ccc(C=C(CC(=O)N2CCCC2)C(=O)N2CCNCC2)cc1)C1CCCc2ccccc21 |
| InChI | InChI=1S/C30H35N3O4.ClH/c34-28(32-16-3-4-17-32)21-24(29(35)33-18-14-31-15-19-33)20-22-10-12-25(13-11-22)37-30(36)27-9-5-7-23-6-1-2-8-26(23)27;/h1-2,6,8,10-13,20,27,31H,3-5,7,9,14-19,21H2;1H |
| InChIKey | KYNICUXARKHXDH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.09 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|