C14H20O3Si — CID 167731553
5-trimethylsilyloxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 167731553) has the molecular formula C14H20O3Si and a molecular weight of 264.40 g/mol. Its IUPAC name is 5-trimethylsilyloxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid.
| Compound Name | 5-trimethylsilyloxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 167731553 |
| Molecular Formula | C14H20O3Si |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 5-trimethylsilyloxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid |
| SMILES | C[Si](C)(C)Oc1cccc2c1CCCC2C(=O)O |
| InChI | InChI=1S/C14H20O3Si/c1-18(2,3)17-13-9-5-6-10-11(13)7-4-8-12(10)14(15)16/h5-6,9,12H,4,7-8H2,1-3H3,(H,15,16) |
| InChIKey | JEDWKTSEFRBAKK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|