C16H22NO3 — CID 59192533
CID 59192533 (PubChem CID 59192533) has the molecular formula C16H22NO3 and a molecular weight of 276.36 g/mol.
| Compound Name | CID 59192533 |
|---|---|
| PubChem CID | 59192533 |
| Molecular Formula | C16H22NO3 |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)COc1cccc2c1CCC[C@H]2[NH] |
| InChI | InChI=1S/C16H22NO3/c1-16(2,3)20-15(18)10-19-14-9-5-6-11-12(14)7-4-8-13(11)17/h5-6,9,13,17H,4,7-8,10H2,1-3H3/t13-/m1/s1 |
| InChIKey | NHDAPMONLMPMNI-CYBMUJFWSA-N |
| XLogP | 3.07 |
| TPSA | 59.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |