About CID 59192533
CID 59192533 (PubChem CID 59192533) has the molecular formula C16H22NO3
and a molecular weight of 276.36 g/mol.
Molecular Properties
| Compound Name | CID 59192533 |
| PubChem CID | 59192533 |
| Molecular Formula | C16H22NO3 |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)COc1cccc2c1CCC[C@H]2[NH] |
| InChI | InChI=1S/C16H22NO3/c1-16(2,3)20-15(18)10-19-14-9-5-6-11-12(14)7-4-8-13(11)17/h5-6,9,13,17H,4,7-8,10H2,1-3H3/t13-/m1/s1 |
| InChIKey | NHDAPMONLMPMNI-CYBMUJFWSA-N |
| XLogP | 3.07 |
| TPSA | 59.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 59192533 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59192533?
The IUPAC name of CID 59192533 (CID 59192533) is not available.
What is the SMILES notation for CID 59192533?
The canonical SMILES for CID 59192533 is CC(C)(C)OC(=O)COc1cccc2c1CCC[C@H]2[NH].
What is the InChIKey of CID 59192533?
The InChIKey is NHDAPMONLMPMNI-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H22NO3/c1-16(2,3)20-15(18)10-19-14-9-5-6-11-12(14)7-4-8-13(11)17/h5-6,9,13,17H,4,7-8,10H2,1-3H3/t13-/m1/s1.
What are the key properties of CID 59192533?
CID 59192533 has a molecular weight of 276.36 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59192533 is sourced from PubChem (CID 59192533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).