C21H26FNO4 — CID 58853654
ethyl 2-[4-[3-(1-aminoethyl)-5-fluorophenoxy]-2-methylphenoxy]-2-methylpropanoate (PubChem CID 58853654) has the molecular formula C21H26FNO4 and a molecular weight of 375.44 g/mol. Its IUPAC name is ethyl 2-[4-[3-(1-aminoethyl)-5-fluorophenoxy]-2-methylphenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[3-(1-aminoethyl)-5-fluorophenoxy]-2-methylphenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 58853654 |
| Molecular Formula | C21H26FNO4 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | ethyl 2-[4-[3-(1-aminoethyl)-5-fluorophenoxy]-2-methylphenoxy]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(Oc2cc(F)cc(C(C)N)c2)cc1C |
| InChI | InChI=1S/C21H26FNO4/c1-6-25-20(24)21(4,5)27-19-8-7-17(9-13(19)2)26-18-11-15(14(3)23)10-16(22)12-18/h7-12,14H,6,23H2,1-5H3 |
| InChIKey | GYXBMTVPPIQHFD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |