C14H20O3S — CID 71192492
ethyl 2-methyl-2-(2-methyl-4-methylsulfanylphenoxy)propanoate (PubChem CID 71192492) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is ethyl 2-methyl-2-(2-methyl-4-methylsulfanylphenoxy)propanoate.
| Compound Name | ethyl 2-methyl-2-(2-methyl-4-methylsulfanylphenoxy)propanoate |
|---|---|
| PubChem CID | 71192492 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | ethyl 2-methyl-2-(2-methyl-4-methylsulfanylphenoxy)propanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(SC)cc1C |
| InChI | InChI=1S/C14H20O3S/c1-6-16-13(15)14(3,4)17-12-8-7-11(18-5)9-10(12)2/h7-9H,6H2,1-5H3 |
| InChIKey | GVGANMLKWMSUAW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |