C28H34O3Se — CID 162172537
ethyl 2-methyl-2-[2-methyl-4-[[4-(4-methylphenyl)phenyl]methylselanyl]phenoxy]propanoate;methane (PubChem CID 162172537) has the molecular formula C28H34O3Se and a molecular weight of 497.54 g/mol. Its IUPAC name is ethyl 2-methyl-2-[2-methyl-4-[[4-(4-methylphenyl)phenyl]methylselanyl]phenoxy]propanoate;methane.
| Compound Name | ethyl 2-methyl-2-[2-methyl-4-[[4-(4-methylphenyl)phenyl]methylselanyl]phenoxy]propanoate;methane |
|---|---|
| PubChem CID | 162172537 |
| Molecular Formula | C28H34O3Se |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | ethyl 2-methyl-2-[2-methyl-4-[[4-(4-methylphenyl)phenyl]methylselanyl]phenoxy]propanoate;methane |
| SMILES | C.CCOC(=O)C(C)(C)Oc1ccc([Se]Cc2ccc(-c3ccc(C)cc3)cc2)cc1C |
| InChI | InChI=1S/C27H30O3Se.CH4/c1-6-29-26(28)27(4,5)30-25-16-15-24(17-20(25)3)31-18-21-9-13-23(14-10-21)22-11-7-19(2)8-12-22;/h7-17H,6,18H2,1-5H3;1H4 |
| InChIKey | ZNZBAZOBSCHCPX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|