C30H32F3NO4 — CID 69346990
ethyl 2-methyl-2-[2-methyl-4-[3-[[4-[3-(trifluoromethyl)phenyl]benzoyl]amino]propyl]phenoxy]propanoate (PubChem CID 69346990) has the molecular formula C30H32F3NO4 and a molecular weight of 527.58 g/mol. Its IUPAC name is ethyl 2-methyl-2-[2-methyl-4-[3-[[4-[3-(trifluoromethyl)phenyl]benzoyl]amino]propyl]phenoxy]propanoate.
| Compound Name | ethyl 2-methyl-2-[2-methyl-4-[3-[[4-[3-(trifluoromethyl)phenyl]benzoyl]amino]propyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 69346990 |
| Molecular Formula | C30H32F3NO4 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | ethyl 2-methyl-2-[2-methyl-4-[3-[[4-[3-(trifluoromethyl)phenyl]benzoyl]amino]propyl]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(CCCNC(=O)c2ccc(-c3cccc(C(F)(F)F)c3)cc2)cc1C |
| InChI | InChI=1S/C30H32F3NO4/c1-5-37-28(36)29(3,4)38-26-16-11-21(18-20(26)2)8-7-17-34-27(35)23-14-12-22(13-15-23)24-9-6-10-25(19-24)30(31,32)33/h6,9-16,18-19H,5,7-8,17H2,1-4H3,(H,34,35) |
| InChIKey | IFJZJDZUUUIQNP-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|