C28H31NO4 — CID 21451956
ethyl 2-methyl-2-[4-[4-[2-[(4-methylbenzoyl)amino]ethyl]phenyl]phenoxy]propanoate (PubChem CID 21451956) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is ethyl 2-methyl-2-[4-[4-[2-[(4-methylbenzoyl)amino]ethyl]phenyl]phenoxy]propanoate.
| Compound Name | ethyl 2-methyl-2-[4-[4-[2-[(4-methylbenzoyl)amino]ethyl]phenyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 21451956 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | ethyl 2-methyl-2-[4-[4-[2-[(4-methylbenzoyl)amino]ethyl]phenyl]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(-c2ccc(CCNC(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H31NO4/c1-5-32-27(31)28(3,4)33-25-16-14-23(15-17-25)22-12-8-21(9-13-22)18-19-29-26(30)24-10-6-20(2)7-11-24/h6-17H,5,18-19H2,1-4H3,(H,29,30) |
| InChIKey | IGBUZMBHLXBNLR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |