C25H36ClNO3 — CID 144618538
4-chloro-N-[2-[4-(2-methyl-3-oxobutan-2-yl)oxyphenyl]ethyl]benzamide;ethane;propane (PubChem CID 144618538) has the molecular formula C25H36ClNO3 and a molecular weight of 434.02 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-(2-methyl-3-oxobutan-2-yl)oxyphenyl]ethyl]benzamide;ethane;propane.
| Compound Name | 4-chloro-N-[2-[4-(2-methyl-3-oxobutan-2-yl)oxyphenyl]ethyl]benzamide;ethane;propane |
|---|---|
| PubChem CID | 144618538 |
| Molecular Formula | C25H36ClNO3 |
| Molecular Weight | 434.02 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 4-chloro-N-[2-[4-(2-methyl-3-oxobutan-2-yl)oxyphenyl]ethyl]benzamide;ethane;propane |
| SMILES | CC.CC(=O)C(C)(C)Oc1ccc(CCNC(=O)c2ccc(Cl)cc2)cc1.CCC |
| InChI | InChI=1S/C20H22ClNO3.C3H8.C2H6/c1-14(23)20(2,3)25-18-10-4-15(5-11-18)12-13-22-19(24)16-6-8-17(21)9-7-16;1-3-2;1-2/h4-11H,12-13H2,1-3H3,(H,22,24);3H2,1-2H3;1-2H3 |
| InChIKey | ZSKOJHKAFJPOGQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.02 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |