C45H60ClN3O4 — CID 77224869
4-chloro-N-[2-[4-[1-[[1-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-methylpropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]oxyphenyl]ethyl]benzamide (PubChem CID 77224869) has the molecular formula C45H60ClN3O4 and a molecular weight of 742.45 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-[1-[[1-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-methylpropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]oxyphenyl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[4-[1-[[1-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-methylpropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]oxyphenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 77224869 |
| Molecular Formula | C45H60ClN3O4 |
| Molecular Weight | 742.45 g/mol |
| Exact Mass | 741.43 |
| IUPAC Name | 4-chloro-N-[2-[4-[1-[[1-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-methylpropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]oxyphenyl]ethyl]benzamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCC(C)(C)NC(=O)C(C)(C)Oc1ccc(CCNC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C45H60ClN3O4/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-41(50)48-36-44(2,3)49-43(52)45(4,5)53-40-32-26-37(27-33-40)34-35-47-42(51)38-28-30-39(46)31-29-38/h7-8,10-11,13-14,16-17,19-20,22-23,26-33H,6,9,12,15,18,21,24-25,34-36H2,1-5H3,(H,47,51)(H,48,50)(H,49,52) |
| InChIKey | VLODGQSFNQJCTE-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.45 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|