C46H59ClN2O6 — CID 67093954
methyl 6-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]hexanoate (PubChem CID 67093954) has the molecular formula C46H59ClN2O6 and a molecular weight of 771.44 g/mol. Its IUPAC name is methyl 6-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]hexanoate |
|---|---|
| PubChem CID | 67093954 |
| Molecular Formula | C46H59ClN2O6 |
| Molecular Weight | 771.44 g/mol |
| Exact Mass | 770.41 |
| IUPAC Name | methyl 6-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]hexanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NC(CCCCNC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)OC |
| InChI | InChI=1S/C46H59ClN2O6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27-42(50)49-41(44(52)54-4)26-24-25-36-48-45(53)46(2,3)55-40-34-30-38(31-35-40)43(51)37-28-32-39(47)33-29-37/h6-7,9-10,12-13,15-16,18-19,21-22,28-35,41H,5,8,11,14,17,20,23-27,36H2,1-4H3,(H,48,53)(H,49,50)/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21- |
| InChIKey | DRWFGCCXXHOCCY-WSDBEMKQSA-N |
| XLogP | 10.15 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.44 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|