C36H52ClN3O3 — CID 51347872
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 51347872) has the molecular formula C36H52ClN3O3 and a molecular weight of 610.28 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 51347872 |
| Molecular Formula | C36H52ClN3O3 |
| Molecular Weight | 610.28 g/mol |
| Exact Mass | 609.37 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCNCCNC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H52ClN3O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-34(41)39-30-28-38-29-31-40-35(42)36(2,3)43-33-26-24-32(37)25-27-33/h5-6,8-9,11-12,14-15,17-18,20-21,24-27,38H,4,7,10,13,16,19,22-23,28-31H2,1-3H3,(H,39,41)(H,40,42)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | NFGWOUGIKMKUBP-YNUSHXQLSA-N |
| XLogP | 7.80 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.28 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|