C26H43N3O — CID 139676066
N-[2-(2-aminoethylamino)ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 139676066) has the molecular formula C26H43N3O and a molecular weight of 413.65 g/mol. Its IUPAC name is N-[2-(2-aminoethylamino)ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | N-[2-(2-aminoethylamino)ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 139676066 |
| Molecular Formula | C26H43N3O |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.34 |
| IUPAC Name | N-[2-(2-aminoethylamino)ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCNCCN |
| InChI | InChI=1S/C26H43N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26(30)29-25-24-28-23-22-27/h3-4,6-7,9-10,12-13,15-16,18-19,28H,2,5,8,11,14,17,20-25,27H2,1H3,(H,29,30) |
| InChIKey | PDYPHBAEYWAPSD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|