C42H55ClN2O4 — CID 129157171
(5Z,8Z,11Z,14Z,17Z)-N-butyl-N-[[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]methyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 129157171) has the molecular formula C42H55ClN2O4 and a molecular weight of 687.37 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-butyl-N-[[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]methyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-butyl-N-[[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]methyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 129157171 |
| Molecular Formula | C42H55ClN2O4 |
| Molecular Weight | 687.37 g/mol |
| Exact Mass | 686.39 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-butyl-N-[[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]methyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N(CCCC)CNC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C42H55ClN2O4/c1-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-39(46)45(33-8-6-2)34-44-41(48)42(3,4)49-38-31-27-36(28-32-38)40(47)35-25-29-37(43)30-26-35/h7,9,11-12,14-15,17-18,20-21,25-32H,5-6,8,10,13,16,19,22-24,33-34H2,1-4H3,(H,44,48)/b9-7-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | GVAUOMAITSWXPS-UKWJBHCSSA-N |
| XLogP | 10.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.37 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|