C45H58ClN3O6 — CID 67093814
methyl 3-[[2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoyl]amino]-2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoate (PubChem CID 67093814) has the molecular formula C45H58ClN3O6 and a molecular weight of 772.43 g/mol. Its IUPAC name is methyl 3-[[2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoyl]amino]-2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoate.
| Compound Name | methyl 3-[[2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoyl]amino]-2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoate |
|---|---|
| PubChem CID | 67093814 |
| Molecular Formula | C45H58ClN3O6 |
| Molecular Weight | 772.43 g/mol |
| Exact Mass | 771.40 |
| IUPAC Name | methyl 3-[[2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoyl]amino]-2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NC(CNC(=O)C(C)(C)Oc1ccc(CCNC(=O)c2ccc(Cl)cc2)cc1)C(=O)OC |
| InChI | InChI=1S/C45H58ClN3O6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-41(50)49-40(43(52)54-4)35-48-44(53)45(2,3)55-39-31-25-36(26-32-39)33-34-47-42(51)37-27-29-38(46)30-28-37/h6-7,9-10,12-13,15-16,18-19,21-22,25-32,40H,5,8,11,14,17,20,23-24,33-35H2,1-4H3,(H,47,51)(H,48,53)(H,49,50) |
| InChIKey | WUHFKCSFRUGEAY-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.43 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|