C27H38ClN2O6P — CID 44760201
4-chloro-N-[2-[4-[1-(4-diethoxyphosphorylbutylamino)-2-methyl-1-oxopropan-2-yl]oxyphenyl]ethyl]benzamide (PubChem CID 44760201) has the molecular formula C27H38ClN2O6P and a molecular weight of 553.04 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-[1-(4-diethoxyphosphorylbutylamino)-2-methyl-1-oxopropan-2-yl]oxyphenyl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[4-[1-(4-diethoxyphosphorylbutylamino)-2-methyl-1-oxopropan-2-yl]oxyphenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 44760201 |
| Molecular Formula | C27H38ClN2O6P |
| Molecular Weight | 553.04 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 4-chloro-N-[2-[4-[1-(4-diethoxyphosphorylbutylamino)-2-methyl-1-oxopropan-2-yl]oxyphenyl]ethyl]benzamide |
| SMILES | CCOP(=O)(CCCCNC(=O)C(C)(C)Oc1ccc(CCNC(=O)c2ccc(Cl)cc2)cc1)OCC |
| InChI | InChI=1S/C27H38ClN2O6P/c1-5-34-37(33,35-6-2)20-8-7-18-30-26(32)27(3,4)36-24-15-9-21(10-16-24)17-19-29-25(31)22-11-13-23(28)14-12-22/h9-16H,5-8,17-20H2,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | VIOMEMVYQUEGBW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.04 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|