C27H26ClNO5S — CID 72550649
S-[2-(4-hydroxyphenyl)-2-oxoethyl] 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanethioate (PubChem CID 72550649) has the molecular formula C27H26ClNO5S and a molecular weight of 512.03 g/mol. Its IUPAC name is S-[2-(4-hydroxyphenyl)-2-oxoethyl] 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanethioate.
| Compound Name | S-[2-(4-hydroxyphenyl)-2-oxoethyl] 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanethioate |
|---|---|
| PubChem CID | 72550649 |
| Molecular Formula | C27H26ClNO5S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | S-[2-(4-hydroxyphenyl)-2-oxoethyl] 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanethioate |
| SMILES | CC(C)(Oc1ccc(CCNC(=O)c2ccc(Cl)cc2)cc1)C(=O)SCC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H26ClNO5S/c1-27(2,26(33)35-17-24(31)19-7-11-22(30)12-8-19)34-23-13-3-18(4-14-23)15-16-29-25(32)20-5-9-21(28)10-6-20/h3-14,30H,15-17H2,1-2H3,(H,29,32) |
| InChIKey | SYFBKITYHCGNRR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|