C16H14ClF2NO2 — CID 27646459
N-[2-(4-chlorophenyl)ethyl]-4-(difluoromethoxy)benzamide (PubChem CID 27646459) has the molecular formula C16H14ClF2NO2 and a molecular weight of 325.74 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-4-(difluoromethoxy)benzamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 27646459 |
| Molecular Formula | C16H14ClF2NO2 |
| Molecular Weight | 325.74 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-4-(difluoromethoxy)benzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H14ClF2NO2/c17-13-5-1-11(2-6-13)9-10-20-15(21)12-3-7-14(8-4-12)22-16(18)19/h1-8,16H,9-10H2,(H,20,21) |
| InChIKey | NOMPEBYOWPBIKG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |