C16H13ClF2N2O3 — CID 9405088
4-chloro-N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]benzamide (PubChem CID 9405088) has the molecular formula C16H13ClF2N2O3 and a molecular weight of 354.74 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9405088 |
| Molecular Formula | C16H13ClF2N2O3 |
| Molecular Weight | 354.74 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 4-chloro-N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)cc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H13ClF2N2O3/c17-11-3-1-10(2-4-11)15(23)20-9-14(22)21-12-5-7-13(8-6-12)24-16(18)19/h1-8,16H,9H2,(H,20,23)(H,21,22) |
| InChIKey | RTWGEYYJDWQUKF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |