C22H18F2N2O4 — CID 9405216
N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-4-phenoxybenzamide (PubChem CID 9405216) has the molecular formula C22H18F2N2O4 and a molecular weight of 412.39 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-4-phenoxybenzamide.
| Compound Name | N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 9405216 |
| Molecular Formula | C22H18F2N2O4 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]-4-phenoxybenzamide |
| SMILES | O=C(CNC(=O)c1ccc(Oc2ccccc2)cc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H18F2N2O4/c23-22(24)30-19-12-8-16(9-13-19)26-20(27)14-25-21(28)15-6-10-18(11-7-15)29-17-4-2-1-3-5-17/h1-13,22H,14H2,(H,25,28)(H,26,27) |
| InChIKey | PKIJNTWKKYEYCZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |