C23H27ClN2O6 — CID 139547470
[(2S)-2-aminopropanoyl]oxymethyl 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoate (PubChem CID 139547470) has the molecular formula C23H27ClN2O6 and a molecular weight of 462.93 g/mol. Its IUPAC name is [(2S)-2-aminopropanoyl]oxymethyl 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoate.
| Compound Name | [(2S)-2-aminopropanoyl]oxymethyl 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 139547470 |
| Molecular Formula | C23H27ClN2O6 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [(2S)-2-aminopropanoyl]oxymethyl 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoate |
| SMILES | C[C@H](N)C(=O)OCOC(=O)C(C)(C)Oc1ccc(CCNC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H27ClN2O6/c1-15(25)21(28)30-14-31-22(29)23(2,3)32-19-10-4-16(5-11-19)12-13-26-20(27)17-6-8-18(24)9-7-17/h4-11,15H,12-14,25H2,1-3H3,(H,26,27)/t15-/m0/s1 |
| InChIKey | YZVWLLVSYQUSHT-HNNXBMFYSA-N |
| XLogP | 2.86 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|