C26H33ClN2O6 — CID 139547582
[2-[4-[2-[(4-chloro-3-methylbenzoyl)amino]ethyl]phenoxy]-2-methylpropanoyl]oxymethyl 2-(aminomethyl)butanoate (PubChem CID 139547582) has the molecular formula C26H33ClN2O6 and a molecular weight of 505.01 g/mol. Its IUPAC name is [2-[4-[2-[(4-chloro-3-methylbenzoyl)amino]ethyl]phenoxy]-2-methylpropanoyl]oxymethyl 2-(aminomethyl)butanoate.
| Compound Name | [2-[4-[2-[(4-chloro-3-methylbenzoyl)amino]ethyl]phenoxy]-2-methylpropanoyl]oxymethyl 2-(aminomethyl)butanoate |
|---|---|
| PubChem CID | 139547582 |
| Molecular Formula | C26H33ClN2O6 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | [2-[4-[2-[(4-chloro-3-methylbenzoyl)amino]ethyl]phenoxy]-2-methylpropanoyl]oxymethyl 2-(aminomethyl)butanoate |
| SMILES | CCC(CN)C(=O)OCOC(=O)C(C)(C)Oc1ccc(CCNC(=O)c2ccc(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C26H33ClN2O6/c1-5-19(15-28)24(31)33-16-34-25(32)26(3,4)35-21-9-6-18(7-10-21)12-13-29-23(30)20-8-11-22(27)17(2)14-20/h6-11,14,19H,5,12-13,15-16,28H2,1-4H3,(H,29,30) |
| InChIKey | UVHULBOCVUBVRS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|