C23H31NO3 — CID 69099777
ethyl 2-methyl-2-[4-[2-(3-phenylpropylamino)ethyl]phenoxy]propanoate (PubChem CID 69099777) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is ethyl 2-methyl-2-[4-[2-(3-phenylpropylamino)ethyl]phenoxy]propanoate.
| Compound Name | ethyl 2-methyl-2-[4-[2-(3-phenylpropylamino)ethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 69099777 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | ethyl 2-methyl-2-[4-[2-(3-phenylpropylamino)ethyl]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(CCNCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H31NO3/c1-4-26-22(25)23(2,3)27-21-14-12-20(13-15-21)16-18-24-17-8-11-19-9-6-5-7-10-19/h5-7,9-10,12-15,24H,4,8,11,16-18H2,1-3H3 |
| InChIKey | CQZXXLOYMHNUCT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|