C11H13NO — CID 174491506
5-amino-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde (PubChem CID 174491506) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 5-amino-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde.
| Compound Name | 5-amino-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 174491506 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 5-amino-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
| SMILES | Nc1cccc2c1CCCC2C=O |
| InChI | InChI=1S/C11H13NO/c12-11-6-2-4-9-8(7-13)3-1-5-10(9)11/h2,4,6-8H,1,3,5,12H2 |
| InChIKey | TTWRFNDDCYZQEC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|