C14H20N2 — CID 105470445
1-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-4-amine (PubChem CID 105470445) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 1-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 105470445 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-4-amine |
| SMILES | Nc1cccc2c1CCC2CN1CCCC1 |
| InChI | InChI=1S/C14H20N2/c15-14-5-3-4-12-11(6-7-13(12)14)10-16-8-1-2-9-16/h3-5,11H,1-2,6-10,15H2 |
| InChIKey | ALLNBZUKJPZEGV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|