C15H22N2 — CID 105488680
8-(pyrrolidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 105488680) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 8-(pyrrolidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | 8-(pyrrolidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 105488680 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 8-(pyrrolidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | Nc1cccc2c1C(CN1CCCC1)CCC2 |
| InChI | InChI=1S/C15H22N2/c16-14-8-4-6-12-5-3-7-13(15(12)14)11-17-9-1-2-10-17/h4,6,8,13H,1-3,5,7,9-11,16H2 |
| InChIKey | WULHWEMGLJQHQD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|