C10H13NO — CID 130673743
(8R)-8-amino-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 130673743) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (8R)-8-amino-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | (8R)-8-amino-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 130673743 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (8R)-8-amino-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | N[C@@H]1CCCc2cccc(O)c21 |
| InChI | InChI=1S/C10H13NO/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h2,4,6,8,12H,1,3,5,11H2/t8-/m1/s1 |
| InChIKey | QJJHFTLFTHWCCP-MRVPVSSYSA-N |
| XLogP | 1.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|