C9H11NOS — CID 131036789
(4R)-4-amino-3,4-dihydro-2H-thiochromen-5-ol (PubChem CID 131036789) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is (4R)-4-amino-3,4-dihydro-2H-thiochromen-5-ol.
| Compound Name | (4R)-4-amino-3,4-dihydro-2H-thiochromen-5-ol |
|---|---|
| PubChem CID | 131036789 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | (4R)-4-amino-3,4-dihydro-2H-thiochromen-5-ol |
| SMILES | N[C@@H]1CCSc2cccc(O)c21 |
| InChI | InChI=1S/C9H11NOS/c10-6-4-5-12-8-3-1-2-7(11)9(6)8/h1-3,6,11H,4-5,10H2/t6-/m1/s1 |
| InChIKey | AWJPWXFYVWPJID-ZCFIWIBFSA-N |
| XLogP | 1.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|